C27H33N3O6S3 — CID 19101087
1,2,3-tris-(4-methylphenyl)sulfonyltriazonane (PubChem CID 19101087) has the molecular formula C27H33N3O6S3 and a molecular weight of 591.78 g/mol. Its IUPAC name is 1,2,3-tris-(4-methylphenyl)sulfonyltriazonane.
| Compound Name | 1,2,3-tris-(4-methylphenyl)sulfonyltriazonane |
|---|---|
| PubChem CID | 19101087 |
| Molecular Formula | C27H33N3O6S3 |
| Molecular Weight | 591.78 g/mol |
| Exact Mass | 591.15 |
| IUPAC Name | 1,2,3-tris-(4-methylphenyl)sulfonyltriazonane |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCCCN(S(=O)(=O)c3ccc(C)cc3)N2S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H33N3O6S3/c1-22-8-14-25(15-9-22)37(31,32)28-20-6-4-5-7-21-29(38(33,34)26-16-10-23(2)11-17-26)30(28)39(35,36)27-18-12-24(3)13-19-27/h8-19H,4-7,20-21H2,1-3H3 |
| InChIKey | CHQKHOARNBDJPV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 112.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.78 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |