C22H32N2O2SSi — CID 71697499
(2E)-2-[3-methyl-1-(4-methylphenyl)sulfonyl-1-azaspiro[4.5]decan-4-ylidene]-2-trimethylsilylacetonitrile (PubChem CID 71697499) has the molecular formula C22H32N2O2SSi and a molecular weight of 416.66 g/mol. Its IUPAC name is (2E)-2-[3-methyl-1-(4-methylphenyl)sulfonyl-1-azaspiro[4.5]decan-4-ylidene]-2-trimethylsilylacetonitrile.
| Compound Name | (2E)-2-[3-methyl-1-(4-methylphenyl)sulfonyl-1-azaspiro[4.5]decan-4-ylidene]-2-trimethylsilylacetonitrile |
|---|---|
| PubChem CID | 71697499 |
| Molecular Formula | C22H32N2O2SSi |
| Molecular Weight | 416.66 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | (2E)-2-[3-methyl-1-(4-methylphenyl)sulfonyl-1-azaspiro[4.5]decan-4-ylidene]-2-trimethylsilylacetonitrile |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(C)/C(=C(/C#N)[Si](C)(C)C)C23CCCCC3)cc1 |
| InChI | InChI=1S/C22H32N2O2SSi/c1-17-9-11-19(12-10-17)27(25,26)24-16-18(2)21(20(15-23)28(3,4)5)22(24)13-7-6-8-14-22/h9-12,18H,6-8,13-14,16H2,1-5H3/b21-20+ |
| InChIKey | BOWBRJUJAPOMFZ-QZQOTICOSA-N |
| XLogP | 5.04 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.66 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|