C17H21BrINO2S — CID 46915556
3-bromo-4-iodo-8-methyl-1-(4-methylphenyl)sulfonyl-1-azaspiro[4.5]dec-3-ene (PubChem CID 46915556) has the molecular formula C17H21BrINO2S and a molecular weight of 510.24 g/mol. Its IUPAC name is 3-bromo-4-iodo-8-methyl-1-(4-methylphenyl)sulfonyl-1-azaspiro[4.5]dec-3-ene.
| Compound Name | 3-bromo-4-iodo-8-methyl-1-(4-methylphenyl)sulfonyl-1-azaspiro[4.5]dec-3-ene |
|---|---|
| PubChem CID | 46915556 |
| Molecular Formula | C17H21BrINO2S |
| Molecular Weight | 510.24 g/mol |
| Exact Mass | 508.95 |
| IUPAC Name | 3-bromo-4-iodo-8-methyl-1-(4-methylphenyl)sulfonyl-1-azaspiro[4.5]dec-3-ene |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(Br)=C(I)C23CCC(C)CC3)cc1 |
| InChI | InChI=1S/C17H21BrINO2S/c1-12-3-5-14(6-4-12)23(21,22)20-11-15(18)16(19)17(20)9-7-13(2)8-10-17/h3-6,13H,7-11H2,1-2H3 |
| InChIKey | HIWMVTKDXVOAJX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.24 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|