C15H14BrIN2O2S — CID 178076035
4-bromo-2-iodo-6-methyl-1-(4-methylphenyl)sulfonyl-7H-pyrrolo[2,3-c]pyridine (PubChem CID 178076035) has the molecular formula C15H14BrIN2O2S and a molecular weight of 493.16 g/mol. Its IUPAC name is 4-bromo-2-iodo-6-methyl-1-(4-methylphenyl)sulfonyl-7H-pyrrolo[2,3-c]pyridine.
| Compound Name | 4-bromo-2-iodo-6-methyl-1-(4-methylphenyl)sulfonyl-7H-pyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 178076035 |
| Molecular Formula | C15H14BrIN2O2S |
| Molecular Weight | 493.16 g/mol |
| Exact Mass | 491.90 |
| IUPAC Name | 4-bromo-2-iodo-6-methyl-1-(4-methylphenyl)sulfonyl-7H-pyrrolo[2,3-c]pyridine |
| SMILES | Cc1ccc(S(=O)(=O)n2c(I)cc3c2CN(C)C=C3Br)cc1 |
| InChI | InChI=1S/C15H14BrIN2O2S/c1-10-3-5-11(6-4-10)22(20,21)19-14-9-18(2)8-13(16)12(14)7-15(19)17/h3-8H,9H2,1-2H3 |
| InChIKey | IXMVBSJMBIEPHB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.16 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|