C8H15N3O3S — CID 177422147
(2R)-5-amino-N-(2-amino-2-oxoethyl)-4-oxo-2-(sulfanylmethyl)pentanamide (PubChem CID 177422147) has the molecular formula C8H15N3O3S and a molecular weight of 233.29 g/mol. Its IUPAC name is (2R)-5-amino-N-(2-amino-2-oxoethyl)-4-oxo-2-(sulfanylmethyl)pentanamide.
| Compound Name | (2R)-5-amino-N-(2-amino-2-oxoethyl)-4-oxo-2-(sulfanylmethyl)pentanamide |
|---|---|
| PubChem CID | 177422147 |
| Molecular Formula | C8H15N3O3S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | (2R)-5-amino-N-(2-amino-2-oxoethyl)-4-oxo-2-(sulfanylmethyl)pentanamide |
| SMILES | NCC(=O)C[C@@H](CS)C(=O)NCC(N)=O |
| InChI | InChI=1S/C8H15N3O3S/c9-2-6(12)1-5(4-15)8(14)11-3-7(10)13/h5,15H,1-4,9H2,(H2,10,13)(H,11,14)/t5-/m0/s1 |
| InChIKey | CEJVDFMIECSPHC-YFKPBYRVSA-N |
| XLogP | -1.95 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|