C16H27NO5S — CID 147047770
N-(3,3-dimethyl-2-oxobutyl)-7-hydroxy-4,8-dioxo-2-(sulfanylmethyl)nonanamide (PubChem CID 147047770) has the molecular formula C16H27NO5S and a molecular weight of 345.46 g/mol. Its IUPAC name is N-(3,3-dimethyl-2-oxobutyl)-7-hydroxy-4,8-dioxo-2-(sulfanylmethyl)nonanamide.
| Compound Name | N-(3,3-dimethyl-2-oxobutyl)-7-hydroxy-4,8-dioxo-2-(sulfanylmethyl)nonanamide |
|---|---|
| PubChem CID | 147047770 |
| Molecular Formula | C16H27NO5S |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | N-(3,3-dimethyl-2-oxobutyl)-7-hydroxy-4,8-dioxo-2-(sulfanylmethyl)nonanamide |
| SMILES | CC(=O)C(O)CCC(=O)CC(CS)C(=O)NCC(=O)C(C)(C)C |
| InChI | InChI=1S/C16H27NO5S/c1-10(18)13(20)6-5-12(19)7-11(9-23)15(22)17-8-14(21)16(2,3)4/h11,13,20,23H,5-9H2,1-4H3,(H,17,22) |
| InChIKey | BASGVVNRTRJOGG-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|