C11H17NO6S — CID 165081744
7-(2-formyloxyethylamino)-4,7-dioxo-6-(sulfanylmethyl)heptanoic acid (PubChem CID 165081744) has the molecular formula C11H17NO6S and a molecular weight of 291.32 g/mol. Its IUPAC name is 7-(2-formyloxyethylamino)-4,7-dioxo-6-(sulfanylmethyl)heptanoic acid.
| Compound Name | 7-(2-formyloxyethylamino)-4,7-dioxo-6-(sulfanylmethyl)heptanoic acid |
|---|---|
| PubChem CID | 165081744 |
| Molecular Formula | C11H17NO6S |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 7-(2-formyloxyethylamino)-4,7-dioxo-6-(sulfanylmethyl)heptanoic acid |
| SMILES | O=COCCNC(=O)C(CS)CC(=O)CCC(=O)O |
| InChI | InChI=1S/C11H17NO6S/c13-7-18-4-3-12-11(17)8(6-19)5-9(14)1-2-10(15)16/h7-8,19H,1-6H2,(H,12,17)(H,15,16) |
| InChIKey | VFWMPPJBENYVQV-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|