C23H18F3NO4S — CID 177426381
(3aR,7aR)-3-methylidene-1-(4-methylphenyl)sulfonyl-7a-[4-(trifluoromethyl)phenyl]-3a,4-dihydroindole-2,5-dione (PubChem CID 177426381) has the molecular formula C23H18F3NO4S and a molecular weight of 461.46 g/mol. Its IUPAC name is (3aR,7aR)-3-methylidene-1-(4-methylphenyl)sulfonyl-7a-[4-(trifluoromethyl)phenyl]-3a,4-dihydroindole-2,5-dione.
| Compound Name | (3aR,7aR)-3-methylidene-1-(4-methylphenyl)sulfonyl-7a-[4-(trifluoromethyl)phenyl]-3a,4-dihydroindole-2,5-dione |
|---|---|
| PubChem CID | 177426381 |
| Molecular Formula | C23H18F3NO4S |
| Molecular Weight | 461.46 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | (3aR,7aR)-3-methylidene-1-(4-methylphenyl)sulfonyl-7a-[4-(trifluoromethyl)phenyl]-3a,4-dihydroindole-2,5-dione |
| SMILES | C=C1C(=O)N(S(=O)(=O)c2ccc(C)cc2)[C@]2(c3ccc(C(F)(F)F)cc3)C=CC(=O)C[C@H]12 |
| InChI | InChI=1S/C23H18F3NO4S/c1-14-3-9-19(10-4-14)32(30,31)27-21(29)15(2)20-13-18(28)11-12-22(20,27)16-5-7-17(8-6-16)23(24,25)26/h3-12,20H,2,13H2,1H3/t20-,22+/m1/s1 |
| InChIKey | HMRNYRNUCOIBJO-IRLDBZIGSA-N |
| XLogP | 4.14 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|