C21H24N2O4S2 — CID 177450788
(NE)-N-[3-butyl-4-(4-methylphenyl)sulfonyl-1H-azet-2-ylidene]-4-methylbenzenesulfonamide (PubChem CID 177450788) has the molecular formula C21H24N2O4S2 and a molecular weight of 432.57 g/mol. Its IUPAC name is (NE)-N-[3-butyl-4-(4-methylphenyl)sulfonyl-1H-azet-2-ylidene]-4-methylbenzenesulfonamide.
| Compound Name | (NE)-N-[3-butyl-4-(4-methylphenyl)sulfonyl-1H-azet-2-ylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 177450788 |
| Molecular Formula | C21H24N2O4S2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | (NE)-N-[3-butyl-4-(4-methylphenyl)sulfonyl-1H-azet-2-ylidene]-4-methylbenzenesulfonamide |
| SMILES | CCCCC1=C(S(=O)(=O)c2ccc(C)cc2)N/C1=N/S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H24N2O4S2/c1-4-5-6-19-20(23-29(26,27)18-13-9-16(3)10-14-18)22-21(19)28(24,25)17-11-7-15(2)8-12-17/h7-14H,4-6H2,1-3H3,(H,22,23) |
| InChIKey | LBJQTLSFMQTGGJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|