C20H23NO3S — CID 164887884
(NE)-N-[(1S,2S,5S)-2-ethynyl-6-methyl-2-propyl-8-oxabicyclo[3.2.1]oct-6-en-3-ylidene]-4-methylbenzenesulfonamide (PubChem CID 164887884) has the molecular formula C20H23NO3S and a molecular weight of 357.48 g/mol. Its IUPAC name is (NE)-N-[(1S,2S,5S)-2-ethynyl-6-methyl-2-propyl-8-oxabicyclo[3.2.1]oct-6-en-3-ylidene]-4-methylbenzenesulfonamide.
| Compound Name | (NE)-N-[(1S,2S,5S)-2-ethynyl-6-methyl-2-propyl-8-oxabicyclo[3.2.1]oct-6-en-3-ylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 164887884 |
| Molecular Formula | C20H23NO3S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | (NE)-N-[(1S,2S,5S)-2-ethynyl-6-methyl-2-propyl-8-oxabicyclo[3.2.1]oct-6-en-3-ylidene]-4-methylbenzenesulfonamide |
| SMILES | C#C[C@@]1(CCC)/C(=N/S(=O)(=O)c2ccc(C)cc2)C[C@@H]2O[C@H]1C=C2C |
| InChI | InChI=1S/C20H23NO3S/c1-5-11-20(6-2)18(13-17-15(4)12-19(20)24-17)21-25(22,23)16-9-7-14(3)8-10-16/h2,7-10,12,17,19H,5,11,13H2,1,3-4H3/b21-18+/t17-,19-,20+/m0/s1 |
| InChIKey | DRJBPKBWOLRSEU-NKXRDCPQSA-N |
| XLogP | 3.66 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|