C25H27N2+ — CID 177457050
1-methyl-4-[(2E,4E,6E,8E,10E,12E)-13-(1-methylpyridin-1-ium-4-yl)trideca-2,4,6,8,10,12-hexaenylidene]pyridine (PubChem CID 177457050) has the molecular formula C25H27N2+ and a molecular weight of 355.51 g/mol. Its IUPAC name is 1-methyl-4-[(2E,4E,6E,8E,10E,12E)-13-(1-methylpyridin-1-ium-4-yl)trideca-2,4,6,8,10,12-hexaenylidene]pyridine.
| Compound Name | 1-methyl-4-[(2E,4E,6E,8E,10E,12E)-13-(1-methylpyridin-1-ium-4-yl)trideca-2,4,6,8,10,12-hexaenylidene]pyridine |
|---|---|
| PubChem CID | 177457050 |
| Molecular Formula | C25H27N2+ |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.22 |
| IUPAC Name | 1-methyl-4-[(2E,4E,6E,8E,10E,12E)-13-(1-methylpyridin-1-ium-4-yl)trideca-2,4,6,8,10,12-hexaenylidene]pyridine |
| SMILES | CN1C=CC(=C/C=C/C=C/C=C/C=C/C=C/C=C/c2cc[n+](C)cc2)C=C1 |
| InChI | InChI=1S/C25H27N2/c1-26-20-16-24(17-21-26)14-12-10-8-6-4-3-5-7-9-11-13-15-25-18-22-27(2)23-19-25/h3-23H,1-2H3/q+1 |
| InChIKey | FKANLHRZKLAPHC-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|