C17H19N2+ — CID 58814520
1-methyl-4-[(2E,4E)-5-(1-methylpyridin-1-ium-4-yl)penta-2,4-dienylidene]pyridine (PubChem CID 58814520) has the molecular formula C17H19N2+ and a molecular weight of 251.35 g/mol. Its IUPAC name is 1-methyl-4-[(2E,4E)-5-(1-methylpyridin-1-ium-4-yl)penta-2,4-dienylidene]pyridine.
| Compound Name | 1-methyl-4-[(2E,4E)-5-(1-methylpyridin-1-ium-4-yl)penta-2,4-dienylidene]pyridine |
|---|---|
| PubChem CID | 58814520 |
| Molecular Formula | C17H19N2+ |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 1-methyl-4-[(2E,4E)-5-(1-methylpyridin-1-ium-4-yl)penta-2,4-dienylidene]pyridine |
| SMILES | CN1C=CC(=C/C=C/C=C/c2cc[n+](C)cc2)C=C1 |
| InChI | InChI=1S/C17H19N2/c1-18-12-8-16(9-13-18)6-4-3-5-7-17-10-14-19(2)15-11-17/h3-15H,1-2H3/q+1 |
| InChIKey | OTBAEQHKISUGHW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|