C17H18N2O5S2 — CID 177469971
(1S,9S)-14-(4-methylphenyl)sulfonyl-11-oxa-12λ6-thia-13,14-diazatricyclo[7.4.1.02,7]tetradeca-2,4,6-triene 12,12-dioxide (PubChem CID 177469971) has the molecular formula C17H18N2O5S2 and a molecular weight of 394.47 g/mol. Its IUPAC name is (1S,9S)-14-(4-methylphenyl)sulfonyl-11-oxa-12λ6-thia-13,14-diazatricyclo[7.4.1.02,7]tetradeca-2,4,6-triene 12,12-dioxide.
| Compound Name | (1S,9S)-14-(4-methylphenyl)sulfonyl-11-oxa-12λ6-thia-13,14-diazatricyclo[7.4.1.02,7]tetradeca-2,4,6-triene 12,12-dioxide |
|---|---|
| PubChem CID | 177469971 |
| Molecular Formula | C17H18N2O5S2 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | (1S,9S)-14-(4-methylphenyl)sulfonyl-11-oxa-12λ6-thia-13,14-diazatricyclo[7.4.1.02,7]tetradeca-2,4,6-triene 12,12-dioxide |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@@H]3COS(=O)(=O)N[C@@H]2c2ccccc2C3)cc1 |
| InChI | InChI=1S/C17H18N2O5S2/c1-12-6-8-15(9-7-12)25(20,21)19-14-10-13-4-2-3-5-16(13)17(19)18-26(22,23)24-11-14/h2-9,14,17-18H,10-11H2,1H3/t14-,17-/m0/s1 |
| InChIKey | XLGOEVMKYNYXEU-YOEHRIQHSA-N |
| XLogP | 1.47 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |