C12H12ClN3OS — CID 177479201
(E)-N-(5-chloro-1,3-benzoxazol-2-yl)-3-propan-2-yl-1,3-thiazetidin-2-imine (PubChem CID 177479201) has the molecular formula C12H12ClN3OS and a molecular weight of 281.77 g/mol. Its IUPAC name is (E)-N-(5-chloro-1,3-benzoxazol-2-yl)-3-propan-2-yl-1,3-thiazetidin-2-imine.
| Compound Name | (E)-N-(5-chloro-1,3-benzoxazol-2-yl)-3-propan-2-yl-1,3-thiazetidin-2-imine |
|---|---|
| PubChem CID | 177479201 |
| Molecular Formula | C12H12ClN3OS |
| Molecular Weight | 281.77 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | (E)-N-(5-chloro-1,3-benzoxazol-2-yl)-3-propan-2-yl-1,3-thiazetidin-2-imine |
| SMILES | CC(C)N1CS/C1=N/c1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C12H12ClN3OS/c1-7(2)16-6-18-12(16)15-11-14-9-5-8(13)3-4-10(9)17-11/h3-5,7H,6H2,1-2H3/b15-12+ |
| InChIKey | LFIIIPGYWSRWSQ-NTCAYCPXSA-N |
| XLogP | 3.88 |
| TPSA | 41.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.77 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|