C33H47NOSi — CID 177482833
N-hex-5-enyl-N-[(E)-3-[methyl(diphenyl)silyl]prop-2-enyl]undec-10-enamide (PubChem CID 177482833) has the molecular formula C33H47NOSi and a molecular weight of 501.83 g/mol. Its IUPAC name is N-hex-5-enyl-N-[(E)-3-[methyl(diphenyl)silyl]prop-2-enyl]undec-10-enamide.
| Compound Name | N-hex-5-enyl-N-[(E)-3-[methyl(diphenyl)silyl]prop-2-enyl]undec-10-enamide |
|---|---|
| PubChem CID | 177482833 |
| Molecular Formula | C33H47NOSi |
| Molecular Weight | 501.83 g/mol |
| Exact Mass | 501.34 |
| IUPAC Name | N-hex-5-enyl-N-[(E)-3-[methyl(diphenyl)silyl]prop-2-enyl]undec-10-enamide |
| SMILES | C=CCCCCCCCCC(=O)N(C/C=C/[Si](C)(c1ccccc1)c1ccccc1)CCCCC=C |
| InChI | InChI=1S/C33H47NOSi/c1-4-6-8-10-11-12-13-20-27-33(35)34(28-21-9-7-5-2)29-22-30-36(3,31-23-16-14-17-24-31)32-25-18-15-19-26-32/h4-5,14-19,22-26,30H,1-2,6-13,20-21,27-29H2,3H3/b30-22+ |
| InChIKey | DNMWTPWMUJKODZ-JBASAIQMSA-N |
| XLogP | 7.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.83 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|