C23H37NO4S2Si — CID 177483270
(3R)-3-hydroxy-4-phenylmethoxy-1-[(4R)-2-sulfanylidene-4-(2-triethylsilyloxypropan-2-yl)-1,3-thiazolidin-3-yl]butan-1-one (PubChem CID 177483270) has the molecular formula C23H37NO4S2Si and a molecular weight of 483.77 g/mol. Its IUPAC name is (3R)-3-hydroxy-4-phenylmethoxy-1-[(4R)-2-sulfanylidene-4-(2-triethylsilyloxypropan-2-yl)-1,3-thiazolidin-3-yl]butan-1-one.
| Compound Name | (3R)-3-hydroxy-4-phenylmethoxy-1-[(4R)-2-sulfanylidene-4-(2-triethylsilyloxypropan-2-yl)-1,3-thiazolidin-3-yl]butan-1-one |
|---|---|
| PubChem CID | 177483270 |
| Molecular Formula | C23H37NO4S2Si |
| Molecular Weight | 483.77 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | (3R)-3-hydroxy-4-phenylmethoxy-1-[(4R)-2-sulfanylidene-4-(2-triethylsilyloxypropan-2-yl)-1,3-thiazolidin-3-yl]butan-1-one |
| SMILES | CC[Si](CC)(CC)OC(C)(C)[C@@H]1CSC(=S)N1C(=O)C[C@@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C23H37NO4S2Si/c1-6-31(7-2,8-3)28-23(4,5)20-17-30-22(29)24(20)21(26)14-19(25)16-27-15-18-12-10-9-11-13-18/h9-13,19-20,25H,6-8,14-17H2,1-5H3/t19-,20+/m1/s1 |
| InChIKey | CEHPVQWXEMTYSX-UXHICEINSA-N |
| XLogP | 4.98 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.77 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|