C41H53BSi — CID 177483763
1-bis(2,4,6-trimethylphenyl)boranylhept-1-en-2-yl-tert-butyl-diphenylsilane (PubChem CID 177483763) has the molecular formula C41H53BSi and a molecular weight of 584.77 g/mol. Its IUPAC name is 1-bis(2,4,6-trimethylphenyl)boranylhept-1-en-2-yl-tert-butyl-diphenylsilane.
| Compound Name | 1-bis(2,4,6-trimethylphenyl)boranylhept-1-en-2-yl-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 177483763 |
| Molecular Formula | C41H53BSi |
| Molecular Weight | 584.77 g/mol |
| Exact Mass | 584.40 |
| IUPAC Name | 1-bis(2,4,6-trimethylphenyl)boranylhept-1-en-2-yl-tert-butyl-diphenylsilane |
| SMILES | CCCCCC(=CB(c1c(C)cc(C)cc1C)c1c(C)cc(C)cc1C)[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C41H53BSi/c1-11-12-15-24-38(43(41(8,9)10,36-20-16-13-17-21-36)37-22-18-14-19-23-37)29-42(39-32(4)25-30(2)26-33(39)5)40-34(6)27-31(3)28-35(40)7/h13-14,16-23,25-29H,11-12,15,24H2,1-10H3 |
| InChIKey | NNELBYWZNAOPMX-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.77 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|