C25H38FN — CID 177486594
(2E,4Z,6Z,8E)-4-fluoro-3,7-dimethyl-N-pentyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine (PubChem CID 177486594) has the molecular formula C25H38FN and a molecular weight of 371.58 g/mol. Its IUPAC name is (2E,4Z,6Z,8E)-4-fluoro-3,7-dimethyl-N-pentyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine.
| Compound Name | (2E,4Z,6Z,8E)-4-fluoro-3,7-dimethyl-N-pentyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine |
|---|---|
| PubChem CID | 177486594 |
| Molecular Formula | C25H38FN |
| Molecular Weight | 371.58 g/mol |
| Exact Mass | 371.30 |
| IUPAC Name | (2E,4Z,6Z,8E)-4-fluoro-3,7-dimethyl-N-pentyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine |
| SMILES | CCCCC/N=C/C=C(C)/C(F)=C/C=C(C)\C=C\C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C25H38FN/c1-7-8-9-18-27-19-16-22(4)24(26)15-13-20(2)12-14-23-21(3)11-10-17-25(23,5)6/h12-16,19H,7-11,17-18H2,1-6H3/b14-12+,20-13-,22-16+,24-15-,27-19+ |
| InChIKey | SZIIPPOYEVIHJD-HERUSRBASA-N |
| XLogP | 8.08 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.58 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|