C33H33N2OS — CID 177488912
CID 177488912 (PubChem CID 177488912) has the molecular formula C33H33N2OS and a molecular weight of 505.71 g/mol.
| Compound Name | CID 177488912 |
|---|---|
| PubChem CID | 177488912 |
| Molecular Formula | C33H33N2OS |
| Molecular Weight | 505.71 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc(-c2ccsc2-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)cc(C(C)(C)C)c1[O] |
| InChI | InChI=1S/C33H33N2OS/c1-32(2,3)25-19-23(20-26(29(25)36)33(4,5)6)24-17-18-37-30(24)31-34-27(21-13-9-7-10-14-21)28(35-31)22-15-11-8-12-16-22/h7-20H,1-6H3,(H,34,35) |
| InChIKey | XSNYZKONHTXCTR-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 48.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.71 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|