C20H18BrF4NO3 — CID 177492413
benzyl N-[4-bromo-2,2,3,3-tetrafluoro-1-(4-methoxyphenyl)pent-4-enyl]carbamate (PubChem CID 177492413) has the molecular formula C20H18BrF4NO3 and a molecular weight of 476.26 g/mol. Its IUPAC name is benzyl N-[4-bromo-2,2,3,3-tetrafluoro-1-(4-methoxyphenyl)pent-4-enyl]carbamate.
| Compound Name | benzyl N-[4-bromo-2,2,3,3-tetrafluoro-1-(4-methoxyphenyl)pent-4-enyl]carbamate |
|---|---|
| PubChem CID | 177492413 |
| Molecular Formula | C20H18BrF4NO3 |
| Molecular Weight | 476.26 g/mol |
| Exact Mass | 475.04 |
| IUPAC Name | benzyl N-[4-bromo-2,2,3,3-tetrafluoro-1-(4-methoxyphenyl)pent-4-enyl]carbamate |
| SMILES | C=C(Br)C(F)(F)C(F)(F)C(NC(=O)OCc1ccccc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H18BrF4NO3/c1-13(21)19(22,23)20(24,25)17(15-8-10-16(28-2)11-9-15)26-18(27)29-12-14-6-4-3-5-7-14/h3-11,17H,1,12H2,2H3,(H,26,27) |
| InChIKey | BBCDGUPOCQVCJC-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.26 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|