C21H26O4S2 — CID 177494231
6-[7-(5-carboxypentyl)-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-yl]hexanoic acid (PubChem CID 177494231) has the molecular formula C21H26O4S2 and a molecular weight of 406.57 g/mol. Its IUPAC name is 6-[7-(5-carboxypentyl)-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-yl]hexanoic acid.
| Compound Name | 6-[7-(5-carboxypentyl)-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-yl]hexanoic acid |
|---|---|
| PubChem CID | 177494231 |
| Molecular Formula | C21H26O4S2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 6-[7-(5-carboxypentyl)-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCC1(CCCCCC(=O)O)c2ccsc2-c2sccc21 |
| InChI | InChI=1S/C21H26O4S2/c22-17(23)7-3-1-5-11-21(12-6-2-4-8-18(24)25)15-9-13-26-19(15)20-16(21)10-14-27-20/h9-10,13-14H,1-8,11-12H2,(H,22,23)(H,24,25) |
| InChIKey | HXRMXDUMQGJXBS-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|