C34H50N2O4 — CID 177494839
(3S,9S,10R)-3,9-dibenzyl-2-heptyl-10-hydroxy-8-methyl-6-propan-2-yl-1-oxa-5,8-diazacyclododecane-4,12-dione (PubChem CID 177494839) has the molecular formula C34H50N2O4 and a molecular weight of 550.78 g/mol. Its IUPAC name is (3S,9S,10R)-3,9-dibenzyl-2-heptyl-10-hydroxy-8-methyl-6-propan-2-yl-1-oxa-5,8-diazacyclododecane-4,12-dione.
| Compound Name | (3S,9S,10R)-3,9-dibenzyl-2-heptyl-10-hydroxy-8-methyl-6-propan-2-yl-1-oxa-5,8-diazacyclododecane-4,12-dione |
|---|---|
| PubChem CID | 177494839 |
| Molecular Formula | C34H50N2O4 |
| Molecular Weight | 550.78 g/mol |
| Exact Mass | 550.38 |
| IUPAC Name | (3S,9S,10R)-3,9-dibenzyl-2-heptyl-10-hydroxy-8-methyl-6-propan-2-yl-1-oxa-5,8-diazacyclododecane-4,12-dione |
| SMILES | CCCCCCCC1OC(=O)C[C@@H](O)[C@H](Cc2ccccc2)N(C)CC(C(C)C)NC(=O)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C34H50N2O4/c1-5-6-7-8-15-20-32-28(21-26-16-11-9-12-17-26)34(39)35-29(25(2)3)24-36(4)30(31(37)23-33(38)40-32)22-27-18-13-10-14-19-27/h9-14,16-19,25,28-32,37H,5-8,15,20-24H2,1-4H3,(H,35,39)/t28-,29?,30-,31+,32?/m0/s1 |
| InChIKey | DFQWAJDSIKAZKM-PMIHTBFISA-N |
| XLogP | 5.57 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.78 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|