C13H21NO2 — CID 178007656
1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]piperidine-3,4-diol (PubChem CID 178007656) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]piperidine-3,4-diol.
| Compound Name | 1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]piperidine-3,4-diol |
|---|---|
| PubChem CID | 178007656 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]piperidine-3,4-diol |
| SMILES | C=C/C=C\C(=C/C)CN1CCC(O)C(O)C1 |
| InChI | InChI=1S/C13H21NO2/c1-3-5-6-11(4-2)9-14-8-7-12(15)13(16)10-14/h3-6,12-13,15-16H,1,7-10H2,2H3/b6-5-,11-4+ |
| InChIKey | HDHSRBCXWCPCKQ-VWXLBWAMSA-N |
| XLogP | 1.10 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|