C20H42N2O4 — CID 178008284
3-(3,3-dimethylbutoxy)-N-[2-[3-oxo-3-(propan-2-ylamino)propoxy]ethyl]butanamide;ethane (PubChem CID 178008284) has the molecular formula C20H42N2O4 and a molecular weight of 374.57 g/mol. Its IUPAC name is 3-(3,3-dimethylbutoxy)-N-[2-[3-oxo-3-(propan-2-ylamino)propoxy]ethyl]butanamide;ethane.
| Compound Name | 3-(3,3-dimethylbutoxy)-N-[2-[3-oxo-3-(propan-2-ylamino)propoxy]ethyl]butanamide;ethane |
|---|---|
| PubChem CID | 178008284 |
| Molecular Formula | C20H42N2O4 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.31 |
| IUPAC Name | 3-(3,3-dimethylbutoxy)-N-[2-[3-oxo-3-(propan-2-ylamino)propoxy]ethyl]butanamide;ethane |
| SMILES | CC.CC(C)NC(=O)CCOCCNC(=O)CC(C)OCCC(C)(C)C |
| InChI | InChI=1S/C18H36N2O4.C2H6/c1-14(2)20-16(21)7-10-23-12-9-19-17(22)13-15(3)24-11-8-18(4,5)6;1-2/h14-15H,7-13H2,1-6H3,(H,19,22)(H,20,21);1-2H3 |
| InChIKey | DOTYSPPBAKGHFW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|