C15H10ClF2N3O — CID 178009283
8-(3-chloro-2,4-difluorophenyl)-6-methoxyquinazolin-4-amine (PubChem CID 178009283) has the molecular formula C15H10ClF2N3O and a molecular weight of 321.71 g/mol. Its IUPAC name is 8-(3-chloro-2,4-difluorophenyl)-6-methoxyquinazolin-4-amine.
| Compound Name | 8-(3-chloro-2,4-difluorophenyl)-6-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 178009283 |
| Molecular Formula | C15H10ClF2N3O |
| Molecular Weight | 321.71 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 8-(3-chloro-2,4-difluorophenyl)-6-methoxyquinazolin-4-amine |
| SMILES | COc1cc(-c2ccc(F)c(Cl)c2F)c2ncnc(N)c2c1 |
| InChI | InChI=1S/C15H10ClF2N3O/c1-22-7-4-9(8-2-3-11(17)12(16)13(8)18)14-10(5-7)15(19)21-6-20-14/h2-6H,1H3,(H2,19,20,21) |
| InChIKey | JMJFTLFENQSWKR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.71 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|