C39H54FN3O6 — CID 178009816
[5-(4-amino-2-methylidenepyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methyl [2,8-dimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl] carbonate (PubChem CID 178009816) has the molecular formula C39H54FN3O6 and a molecular weight of 679.87 g/mol. Its IUPAC name is [5-(4-amino-2-methylidenepyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methyl [2,8-dimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl] carbonate.
| Compound Name | [5-(4-amino-2-methylidenepyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methyl [2,8-dimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl] carbonate |
|---|---|
| PubChem CID | 178009816 |
| Molecular Formula | C39H54FN3O6 |
| Molecular Weight | 679.87 g/mol |
| Exact Mass | 679.40 |
| IUPAC Name | [5-(4-amino-2-methylidenepyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methyl [2,8-dimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl] carbonate |
| SMILES | C=C1N=C(N)C=CN1C1OC(COC(=O)Oc2cc(C)c3c(c2)CCC(C)(CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)O3)C(O)C1(C)F |
| InChI | InChI=1S/C39H54FN3O6/c1-25(2)12-9-13-26(3)14-10-15-27(4)16-11-19-38(7)20-17-30-23-31(22-28(5)34(30)49-38)47-37(45)46-24-32-35(44)39(8,40)36(48-32)43-21-18-33(41)42-29(43)6/h12,14,16,18,21-23,32,35-36,44H,6,9-11,13,15,17,19-20,24H2,1-5,7-8H3,(H2,41,42)/b26-14+,27-16+ |
| InChIKey | PHQKCTRMVDOURG-AEIISLFXSA-N |
| XLogP | 8.27 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.87 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|