About CID 178016458
CID 178016458 (PubChem CID 178016458) has the molecular formula C6H11BO3S
and a molecular weight of 174.03 g/mol.
Molecular Properties
| Compound Name | CID 178016458 |
| PubChem CID | 178016458 |
| Molecular Formula | C6H11BO3S |
| Molecular Weight | 174.03 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | — |
| SMILES | [B]C1OC(CS)C(OC)C1O |
| InChI | InChI=1S/C6H11BO3S/c1-9-5-3(2-11)10-6(7)4(5)8/h3-6,8,11H,2H2,1H3 |
| InChIKey | ZVDPUCVAOCUYKY-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.03 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 178016458 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 178016458?
The IUPAC name of CID 178016458 (CID 178016458) is not available.
What is the SMILES notation for CID 178016458?
The canonical SMILES for CID 178016458 is [B]C1OC(CS)C(OC)C1O.
What is the InChIKey of CID 178016458?
The InChIKey is ZVDPUCVAOCUYKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11BO3S/c1-9-5-3(2-11)10-6(7)4(5)8/h3-6,8,11H,2H2,1H3.
What are the key properties of CID 178016458?
CID 178016458 has a molecular weight of 174.03 g/mol, XLogP of -0.81, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 178016458 is sourced from PubChem (CID 178016458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).