C32H40ClN3O7 — CID 178027048
(2S)-1-[2-[[3-[4-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenoxy]cyclohexyl]amino]acetyl]pyrrolidine-2-carbonitrile (PubChem CID 178027048) has the molecular formula C32H40ClN3O7 and a molecular weight of 614.14 g/mol. Its IUPAC name is (2S)-1-[2-[[3-[4-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenoxy]cyclohexyl]amino]acetyl]pyrrolidine-2-carbonitrile.
| Compound Name | (2S)-1-[2-[[3-[4-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenoxy]cyclohexyl]amino]acetyl]pyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 178027048 |
| Molecular Formula | C32H40ClN3O7 |
| Molecular Weight | 614.14 g/mol |
| Exact Mass | 613.26 |
| IUPAC Name | (2S)-1-[2-[[3-[4-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenoxy]cyclohexyl]amino]acetyl]pyrrolidine-2-carbonitrile |
| SMILES | N#C[C@@H]1CCCN1C(=O)CNC1CCCC(Oc2ccc(Cc3cc([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)ccc3Cl)cc2)C1 |
| InChI | InChI=1S/C32H40ClN3O7/c33-26-11-8-20(32-31(41)30(40)29(39)27(18-37)43-32)14-21(26)13-19-6-9-24(10-7-19)42-25-5-1-3-22(15-25)35-17-28(38)36-12-2-4-23(36)16-34/h6-11,14,22-23,25,27,29-32,35,37,39-41H,1-5,12-13,15,17-18H2/t22?,23-,25?,27+,29+,30-,31+,32-/m0/s1 |
| InChIKey | JXLHUJWNHPWFET-MHQRGMOQSA-N |
| XLogP | 2.24 |
| TPSA | 155.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.14 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |