C26H35N3O4S — CID 178035149
3-[2-(3-but-3-ynyldiazirin-3-yl)ethoxy-dimethyl-λ4-sulfanyl]propyl 3-oxospiro[1H-indene-2,4'-piperidine]-1'-carboxylate (PubChem CID 178035149) has the molecular formula C26H35N3O4S and a molecular weight of 485.65 g/mol. Its IUPAC name is 3-[2-(3-but-3-ynyldiazirin-3-yl)ethoxy-dimethyl-λ4-sulfanyl]propyl 3-oxospiro[1H-indene-2,4'-piperidine]-1'-carboxylate.
| Compound Name | 3-[2-(3-but-3-ynyldiazirin-3-yl)ethoxy-dimethyl-λ4-sulfanyl]propyl 3-oxospiro[1H-indene-2,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 178035149 |
| Molecular Formula | C26H35N3O4S |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | 3-[2-(3-but-3-ynyldiazirin-3-yl)ethoxy-dimethyl-λ4-sulfanyl]propyl 3-oxospiro[1H-indene-2,4'-piperidine]-1'-carboxylate |
| SMILES | C#CCCC1(CCOS(C)(C)CCCOC(=O)N2CCC3(CC2)Cc2ccccc2C3=O)N=N1 |
| InChI | InChI=1S/C26H35N3O4S/c1-4-5-11-26(27-28-26)14-18-33-34(2,3)19-8-17-32-24(31)29-15-12-25(13-16-29)20-21-9-6-7-10-22(21)23(25)30/h1,6-7,9-10H,5,8,11-20H2,2-3H3 |
| InChIKey | VUADSTFZNZOTHG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|