C15H18F3NO6S — CID 178035848
methyl 2-(2,2-dimethylpropanoylamino)-2-[4-(trifluoromethylsulfonyloxy)phenyl]acetate (PubChem CID 178035848) has the molecular formula C15H18F3NO6S and a molecular weight of 397.37 g/mol. Its IUPAC name is methyl 2-(2,2-dimethylpropanoylamino)-2-[4-(trifluoromethylsulfonyloxy)phenyl]acetate.
| Compound Name | methyl 2-(2,2-dimethylpropanoylamino)-2-[4-(trifluoromethylsulfonyloxy)phenyl]acetate |
|---|---|
| PubChem CID | 178035848 |
| Molecular Formula | C15H18F3NO6S |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | methyl 2-(2,2-dimethylpropanoylamino)-2-[4-(trifluoromethylsulfonyloxy)phenyl]acetate |
| SMILES | COC(=O)C(NC(=O)C(C)(C)C)c1ccc(OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H18F3NO6S/c1-14(2,3)13(21)19-11(12(20)24-4)9-5-7-10(8-6-9)25-26(22,23)15(16,17)18/h5-8,11H,1-4H3,(H,19,21) |
| InChIKey | ALVVWGAAZGLUAG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|