C16H38N2O — CID 178037223
N,N-dipropylbutan-1-amine;ethane;2-(ethylamino)acetaldehyde (PubChem CID 178037223) has the molecular formula C16H38N2O and a molecular weight of 274.49 g/mol. Its IUPAC name is N,N-dipropylbutan-1-amine;ethane;2-(ethylamino)acetaldehyde.
| Compound Name | N,N-dipropylbutan-1-amine;ethane;2-(ethylamino)acetaldehyde |
|---|---|
| PubChem CID | 178037223 |
| Molecular Formula | C16H38N2O |
| Molecular Weight | 274.49 g/mol |
| Exact Mass | 274.30 |
| IUPAC Name | N,N-dipropylbutan-1-amine;ethane;2-(ethylamino)acetaldehyde |
| SMILES | CC.CCCCN(CCC)CCC.CCNCC=O |
| InChI | InChI=1S/C10H23N.C4H9NO.C2H6/c1-4-7-10-11(8-5-2)9-6-3;1-2-5-3-4-6;1-2/h4-10H2,1-3H3;4-5H,2-3H2,1H3;1-2H3 |
| InChIKey | MKWKGYOPCDICSR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|