C9H14F3N — CID 178040101
(Z)-N-methyl-4-(2,2,2-trifluoroethyl)hex-4-en-3-imine (PubChem CID 178040101) has the molecular formula C9H14F3N and a molecular weight of 193.21 g/mol. Its IUPAC name is (Z)-N-methyl-4-(2,2,2-trifluoroethyl)hex-4-en-3-imine.
| Compound Name | (Z)-N-methyl-4-(2,2,2-trifluoroethyl)hex-4-en-3-imine |
|---|---|
| PubChem CID | 178040101 |
| Molecular Formula | C9H14F3N |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (Z)-N-methyl-4-(2,2,2-trifluoroethyl)hex-4-en-3-imine |
| SMILES | C/C=C(CC(F)(F)F)\C(CC)=N\C |
| InChI | InChI=1S/C9H14F3N/c1-4-7(6-9(10,11)12)8(5-2)13-3/h4H,5-6H2,1-3H3/b7-4-,13-8+ |
| InChIKey | UHZLGADRSGOAQK-PZADHXCOSA-N |
| XLogP | 3.37 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|