C24H24O5 — CID 178046171
(2E,4E)-4-ethenyl-1-(2-hydroxy-3,6-dimethoxy-4-phenylmethoxyphenyl)hepta-2,4,6-trien-1-one (PubChem CID 178046171) has the molecular formula C24H24O5 and a molecular weight of 392.45 g/mol. Its IUPAC name is (2E,4E)-4-ethenyl-1-(2-hydroxy-3,6-dimethoxy-4-phenylmethoxyphenyl)hepta-2,4,6-trien-1-one.
| Compound Name | (2E,4E)-4-ethenyl-1-(2-hydroxy-3,6-dimethoxy-4-phenylmethoxyphenyl)hepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 178046171 |
| Molecular Formula | C24H24O5 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | (2E,4E)-4-ethenyl-1-(2-hydroxy-3,6-dimethoxy-4-phenylmethoxyphenyl)hepta-2,4,6-trien-1-one |
| SMILES | C=C/C=C(C=C)/C=C/C(=O)c1c(OC)cc(OCc2ccccc2)c(OC)c1O |
| InChI | InChI=1S/C24H24O5/c1-5-10-17(6-2)13-14-19(25)22-20(27-3)15-21(24(28-4)23(22)26)29-16-18-11-8-7-9-12-18/h5-15,26H,1-2,16H2,3-4H3/b14-13+,17-10+ |
| InChIKey | HFXIPZVIADLFHX-SPNTWFQYSA-N |
| XLogP | 5.03 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|