C25H36N4O2S2 — CID 178048940
ethane;6-methoxy-2-methyl-1,3-benzothiazol-4-amine;2-methyl-6-pyrrolidin-3-yloxy-1,3-benzothiazole (PubChem CID 178048940) has the molecular formula C25H36N4O2S2 and a molecular weight of 488.72 g/mol. Its IUPAC name is ethane;6-methoxy-2-methyl-1,3-benzothiazol-4-amine;2-methyl-6-pyrrolidin-3-yloxy-1,3-benzothiazole.
| Compound Name | ethane;6-methoxy-2-methyl-1,3-benzothiazol-4-amine;2-methyl-6-pyrrolidin-3-yloxy-1,3-benzothiazole |
|---|---|
| PubChem CID | 178048940 |
| Molecular Formula | C25H36N4O2S2 |
| Molecular Weight | 488.72 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | ethane;6-methoxy-2-methyl-1,3-benzothiazol-4-amine;2-methyl-6-pyrrolidin-3-yloxy-1,3-benzothiazole |
| SMILES | CC.CC.COc1cc(N)c2nc(C)sc2c1.Cc1nc2ccc(OC3CCNC3)cc2s1 |
| InChI | InChI=1S/C12H14N2OS.C9H10N2OS.2C2H6/c1-8-14-11-3-2-9(6-12(11)16-8)15-10-4-5-13-7-10;1-5-11-9-7(10)3-6(12-2)4-8(9)13-5;2*1-2/h2-3,6,10,13H,4-5,7H2,1H3;3-4H,10H2,1-2H3;2*1-2H3 |
| InChIKey | LZPUYPOEQPFUHS-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.72 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|