About 6-cyclopropyloxy-4-methoxy-2-methyl-1,3-benzothiazole;ethane
6-cyclopropyloxy-4-methoxy-2-methyl-1,3-benzothiazole;ethane (PubChem CID 178049165) has the molecular formula C16H25NO2S
and a molecular weight of 295.45 g/mol. Its IUPAC name is 6-cyclopropyloxy-4-methoxy-2-methyl-1,3-benzothiazole;ethane.
Molecular Properties
| Compound Name | 6-cyclopropyloxy-4-methoxy-2-methyl-1,3-benzothiazole;ethane |
| PubChem CID | 178049165 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 6-cyclopropyloxy-4-methoxy-2-methyl-1,3-benzothiazole;ethane |
| SMILES | CC.CC.COc1cc(OC2CC2)cc2sc(C)nc12 |
| InChI | InChI=1S/C12H13NO2S.2C2H6/c1-7-13-12-10(14-2)5-9(6-11(12)16-7)15-8-3-4-8;2*1-2/h5-6,8H,3-4H2,1-2H3;2*1-2H3 |
| InChIKey | ISEPSYWJSHCLRT-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-cyclopropyloxy-4-methoxy-2-methyl-1,3-benzothiazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclopropyloxy-4-methoxy-2-methyl-1,3-benzothiazole;ethane?
The IUPAC name of 6-cyclopropyloxy-4-methoxy-2-methyl-1,3-benzothiazole;ethane (CID 178049165) is 6-cyclopropyloxy-4-methoxy-2-methyl-1,3-benzothiazole;ethane.
What is the SMILES notation for 6-cyclopropyloxy-4-methoxy-2-methyl-1,3-benzothiazole;ethane?
The canonical SMILES for 6-cyclopropyloxy-4-methoxy-2-methyl-1,3-benzothiazole;ethane is CC.CC.COc1cc(OC2CC2)cc2sc(C)nc12.
What is the InChIKey of 6-cyclopropyloxy-4-methoxy-2-methyl-1,3-benzothiazole;ethane?
The InChIKey is ISEPSYWJSHCLRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2S.2C2H6/c1-7-13-12-10(14-2)5-9(6-11(12)16-7)15-8-3-4-8;2*1-2/h5-6,8H,3-4H2,1-2H3;2*1-2H3.
What are the key properties of 6-cyclopropyloxy-4-methoxy-2-methyl-1,3-benzothiazole;ethane?
6-cyclopropyloxy-4-methoxy-2-methyl-1,3-benzothiazole;ethane has a molecular weight of 295.45 g/mol, XLogP of 5.21, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclopropyloxy-4-methoxy-2-methyl-1,3-benzothiazole;ethane is sourced from PubChem (CID 178049165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).