C6H5N3OS — CID 178052726
4-sulfanylidene-5,7-dihydro-1H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 178052726) has the molecular formula C6H5N3OS and a molecular weight of 167.19 g/mol. Its IUPAC name is 4-sulfanylidene-5,7-dihydro-1H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-sulfanylidene-5,7-dihydro-1H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 178052726 |
| Molecular Formula | C6H5N3OS |
| Molecular Weight | 167.19 g/mol |
| Exact Mass | 167.02 |
| IUPAC Name | 4-sulfanylidene-5,7-dihydro-1H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | O=C1Cc2c([nH]cnc2=S)N1 |
| InChI | InChI=1S/C6H5N3OS/c10-4-1-3-5(9-4)7-2-8-6(3)11/h2H,1H2,(H2,7,8,9,10,11) |
| InChIKey | QZNZDKCYYUKYQA-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.19 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|