C36H61NO2Si — CID 178054256
2-[2-[tert-butyl-bis(3,5-ditert-butylphenyl)silyl]oxyethylamino]ethanol (PubChem CID 178054256) has the molecular formula C36H61NO2Si and a molecular weight of 567.98 g/mol. Its IUPAC name is 2-[2-[tert-butyl-bis(3,5-ditert-butylphenyl)silyl]oxyethylamino]ethanol.
| Compound Name | 2-[2-[tert-butyl-bis(3,5-ditert-butylphenyl)silyl]oxyethylamino]ethanol |
|---|---|
| PubChem CID | 178054256 |
| Molecular Formula | C36H61NO2Si |
| Molecular Weight | 567.98 g/mol |
| Exact Mass | 567.45 |
| IUPAC Name | 2-[2-[tert-butyl-bis(3,5-ditert-butylphenyl)silyl]oxyethylamino]ethanol |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)cc([Si](OCCNCCO)(c2cc(C(C)(C)C)cc(C(C)(C)C)c2)C(C)(C)C)c1 |
| InChI | InChI=1S/C36H61NO2Si/c1-32(2,3)26-20-27(33(4,5)6)23-30(22-26)40(36(13,14)15,39-19-17-37-16-18-38)31-24-28(34(7,8)9)21-29(25-31)35(10,11)12/h20-25,37-38H,16-19H2,1-15H3 |
| InChIKey | ZCSAZURFUHKQTE-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.98 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|