C33H44BF3N2O9 — CID 178056769
tert-butyl (2S)-3-[2-methoxy-4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethoxy)benzoyl]amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 178056769) has the molecular formula C33H44BF3N2O9 and a molecular weight of 680.53 g/mol. Its IUPAC name is tert-butyl (2S)-3-[2-methoxy-4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethoxy)benzoyl]amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | tert-butyl (2S)-3-[2-methoxy-4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethoxy)benzoyl]amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 178056769 |
| Molecular Formula | C33H44BF3N2O9 |
| Molecular Weight | 680.53 g/mol |
| Exact Mass | 680.31 |
| IUPAC Name | tert-butyl (2S)-3-[2-methoxy-4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethoxy)benzoyl]amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | COc1cc(NC(=O)c2cc(B3OC(C)(C)C(C)(C)O3)ccc2OC(F)(F)F)ccc1C[C@H](NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H44BF3N2O9/c1-29(2,3)45-27(41)23(39-28(42)46-30(4,5)6)16-19-12-14-21(18-25(19)43-11)38-26(40)22-17-20(13-15-24(22)44-33(35,36)37)34-47-31(7,8)32(9,10)48-34/h12-15,17-18,23H,16H2,1-11H3,(H,38,40)(H,39,42)/t23-/m0/s1 |
| InChIKey | LYRRCIMCIWPKBN-QHCPKHFHSA-N |
| XLogP | 5.92 |
| TPSA | 130.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.53 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|