C23H19FO10 — CID 178057088
[(3R)-5-hydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 2-fluoro-3,4-dihydroxy-5-methoxybenzoate (PubChem CID 178057088) has the molecular formula C23H19FO10 and a molecular weight of 474.39 g/mol. Its IUPAC name is [(3R)-5-hydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 2-fluoro-3,4-dihydroxy-5-methoxybenzoate.
| Compound Name | [(3R)-5-hydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 2-fluoro-3,4-dihydroxy-5-methoxybenzoate |
|---|---|
| PubChem CID | 178057088 |
| Molecular Formula | C23H19FO10 |
| Molecular Weight | 474.39 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | [(3R)-5-hydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 2-fluoro-3,4-dihydroxy-5-methoxybenzoate |
| SMILES | COc1cc(C(=O)O[C@@H]2Cc3c(O)cccc3OC2c2cc(O)c(O)c(O)c2)c(F)c(O)c1O |
| InChI | InChI=1S/C23H19FO10/c1-32-16-8-11(18(24)21(30)20(16)29)23(31)34-17-7-10-12(25)3-2-4-15(10)33-22(17)9-5-13(26)19(28)14(27)6-9/h2-6,8,17,22,25-30H,7H2,1H3/t17-,22?/m1/s1 |
| InChIKey | XSFRTAXXPRDVDA-PLEWWHCXSA-N |
| XLogP | 2.97 |
| TPSA | 166.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|