C28H36FN3O3 — CID 178058098
benzyl N-[1-(1-methyl-2H-pyridin-5-yl)propan-2-yl]carbamate;N-[1-(4-fluorophenyl)-2-methylpropan-2-yl]formamide (PubChem CID 178058098) has the molecular formula C28H36FN3O3 and a molecular weight of 481.61 g/mol. Its IUPAC name is benzyl N-[1-(1-methyl-2H-pyridin-5-yl)propan-2-yl]carbamate;N-[1-(4-fluorophenyl)-2-methylpropan-2-yl]formamide.
| Compound Name | benzyl N-[1-(1-methyl-2H-pyridin-5-yl)propan-2-yl]carbamate;N-[1-(4-fluorophenyl)-2-methylpropan-2-yl]formamide |
|---|---|
| PubChem CID | 178058098 |
| Molecular Formula | C28H36FN3O3 |
| Molecular Weight | 481.61 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | benzyl N-[1-(1-methyl-2H-pyridin-5-yl)propan-2-yl]carbamate;N-[1-(4-fluorophenyl)-2-methylpropan-2-yl]formamide |
| SMILES | CC(C)(Cc1ccc(F)cc1)NC=O.CC(CC1=CN(C)CC=C1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H22N2O2.C11H14FNO/c1-14(11-16-9-6-10-19(2)12-16)18-17(20)21-13-15-7-4-3-5-8-15;1-11(2,13-8-14)7-9-3-5-10(12)6-4-9/h3-9,12,14H,10-11,13H2,1-2H3,(H,18,20);3-6,8H,7H2,1-2H3,(H,13,14) |
| InChIKey | ZRYHCLPORDGZLK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.61 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|