C20H25N3O4 — CID 178066215
6-(1,3-benzodioxol-5-yl)-1,11-dimethyl-3,6,9-triazatricyclo[7.3.1.13,11]tetradecane-4,8-dione (PubChem CID 178066215) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-yl)-1,11-dimethyl-3,6,9-triazatricyclo[7.3.1.13,11]tetradecane-4,8-dione.
| Compound Name | 6-(1,3-benzodioxol-5-yl)-1,11-dimethyl-3,6,9-triazatricyclo[7.3.1.13,11]tetradecane-4,8-dione |
|---|---|
| PubChem CID | 178066215 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 6-(1,3-benzodioxol-5-yl)-1,11-dimethyl-3,6,9-triazatricyclo[7.3.1.13,11]tetradecane-4,8-dione |
| SMILES | CC12CN3CC(C)(CN(C1)C(=O)CN(c1ccc4c(c1)OCO4)CC3=O)C2 |
| InChI | InChI=1S/C20H25N3O4/c1-19-8-20(2)11-22(9-19)17(24)6-21(7-18(25)23(10-19)12-20)14-3-4-15-16(5-14)27-13-26-15/h3-5H,6-13H2,1-2H3 |
| InChIKey | BRUGWDHKXSQCOB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|