C21H29NO3Si — CID 178066805
(1S,12R,13R)-12-[tert-butyl(dimethyl)silyl]oxy-6-methyl-16-oxa-7-azatetracyclo[11.2.1.02,11.03,8]hexadeca-2(11),3(8),5,9-tetraen-4-one (PubChem CID 178066805) has the molecular formula C21H29NO3Si and a molecular weight of 371.55 g/mol. Its IUPAC name is (1S,12R,13R)-12-[tert-butyl(dimethyl)silyl]oxy-6-methyl-16-oxa-7-azatetracyclo[11.2.1.02,11.03,8]hexadeca-2(11),3(8),5,9-tetraen-4-one.
| Compound Name | (1S,12R,13R)-12-[tert-butyl(dimethyl)silyl]oxy-6-methyl-16-oxa-7-azatetracyclo[11.2.1.02,11.03,8]hexadeca-2(11),3(8),5,9-tetraen-4-one |
|---|---|
| PubChem CID | 178066805 |
| Molecular Formula | C21H29NO3Si |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | (1S,12R,13R)-12-[tert-butyl(dimethyl)silyl]oxy-6-methyl-16-oxa-7-azatetracyclo[11.2.1.02,11.03,8]hexadeca-2(11),3(8),5,9-tetraen-4-one |
| SMILES | Cc1cc(=O)c2c3c(ccc2[nH]1)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@@H]3O1 |
| InChI | InChI=1S/C21H29NO3Si/c1-12-11-15(23)19-14(22-12)8-7-13-18(19)16-9-10-17(24-16)20(13)25-26(5,6)21(2,3)4/h7-8,11,16-17,20H,9-10H2,1-6H3,(H,22,23)/t16-,17+,20+/m0/s1 |
| InChIKey | SBHBZLGTCVXXKD-SQGPQFPESA-N |
| XLogP | 5.13 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|