C20H16F3N5O2 — CID 178068426
2-(pyridin-4-ylmethylamino)-N-[(E)-[4-(trifluoromethoxy)phenyl]methylideneamino]pyridine-3-carboxamide (PubChem CID 178068426) has the molecular formula C20H16F3N5O2 and a molecular weight of 415.38 g/mol. Its IUPAC name is 2-(pyridin-4-ylmethylamino)-N-[(E)-[4-(trifluoromethoxy)phenyl]methylideneamino]pyridine-3-carboxamide.
| Compound Name | 2-(pyridin-4-ylmethylamino)-N-[(E)-[4-(trifluoromethoxy)phenyl]methylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 178068426 |
| Molecular Formula | C20H16F3N5O2 |
| Molecular Weight | 415.38 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 2-(pyridin-4-ylmethylamino)-N-[(E)-[4-(trifluoromethoxy)phenyl]methylideneamino]pyridine-3-carboxamide |
| SMILES | O=C(N/N=C/c1ccc(OC(F)(F)F)cc1)c1cccnc1NCc1ccncc1 |
| InChI | InChI=1S/C20H16F3N5O2/c21-20(22,23)30-16-5-3-14(4-6-16)13-27-28-19(29)17-2-1-9-25-18(17)26-12-15-7-10-24-11-8-15/h1-11,13H,12H2,(H,25,26)(H,28,29)/b27-13+ |
| InChIKey | OMFIZKMEJUNTEI-UVHMKAGCSA-N |
| XLogP | 3.75 |
| TPSA | 88.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|