C56H109NO7 — CID 178070097
3,3-bis(3-butylheptoxy)propyl 6-[2-hydroxyethyl-[5-hydroxy-5-[(9Z,12Z)-octadeca-9,12-dienoxy]pentyl]amino]hexanoate (PubChem CID 178070097) has the molecular formula C56H109NO7 and a molecular weight of 908.49 g/mol. Its IUPAC name is 3,3-bis(3-butylheptoxy)propyl 6-[2-hydroxyethyl-[5-hydroxy-5-[(9Z,12Z)-octadeca-9,12-dienoxy]pentyl]amino]hexanoate.
| Compound Name | 3,3-bis(3-butylheptoxy)propyl 6-[2-hydroxyethyl-[5-hydroxy-5-[(9Z,12Z)-octadeca-9,12-dienoxy]pentyl]amino]hexanoate |
|---|---|
| PubChem CID | 178070097 |
| Molecular Formula | C56H109NO7 |
| Molecular Weight | 908.49 g/mol |
| Exact Mass | 907.82 |
| IUPAC Name | 3,3-bis(3-butylheptoxy)propyl 6-[2-hydroxyethyl-[5-hydroxy-5-[(9Z,12Z)-octadeca-9,12-dienoxy]pentyl]amino]hexanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC(O)CCCCN(CCO)CCCCCC(=O)OCCC(OCCC(CCCC)CCCC)OCCC(CCCC)CCCC |
| InChI | InChI=1S/C56H109NO7/c1-6-11-16-17-18-19-20-21-22-23-24-25-26-27-28-34-48-61-54(59)40-31-33-45-57(46-47-58)44-32-29-30-39-55(60)62-51-43-56(63-49-41-52(35-12-7-2)36-13-8-3)64-50-42-53(37-14-9-4)38-15-10-5/h18-19,21-22,52-54,56,58-59H,6-17,20,23-51H2,1-5H3/b19-18-,22-21- |
| InChIKey | BOJVSOZFLDNNPI-VYEFPUSRSA-N |
| XLogP | 15.23 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 908.49 |
| LogP ≤ 5 | 15.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|