C47H85NO5S2 — CID 178085199
2-[4-[2-[2-(1-adamantyl)acetyl]oxyethyl]-1-(4-hydroxybutyl)piperidin-4-yl]ethyl 4,4-bis(nonylsulfanyl)butanoate (PubChem CID 178085199) has the molecular formula C47H85NO5S2 and a molecular weight of 808.33 g/mol. Its IUPAC name is 2-[4-[2-[2-(1-adamantyl)acetyl]oxyethyl]-1-(4-hydroxybutyl)piperidin-4-yl]ethyl 4,4-bis(nonylsulfanyl)butanoate.
| Compound Name | 2-[4-[2-[2-(1-adamantyl)acetyl]oxyethyl]-1-(4-hydroxybutyl)piperidin-4-yl]ethyl 4,4-bis(nonylsulfanyl)butanoate |
|---|---|
| PubChem CID | 178085199 |
| Molecular Formula | C47H85NO5S2 |
| Molecular Weight | 808.33 g/mol |
| Exact Mass | 807.59 |
| IUPAC Name | 2-[4-[2-[2-(1-adamantyl)acetyl]oxyethyl]-1-(4-hydroxybutyl)piperidin-4-yl]ethyl 4,4-bis(nonylsulfanyl)butanoate |
| SMILES | CCCCCCCCCSC(CCC(=O)OCCC1(CCOC(=O)CC23CC4CC(CC(C4)C2)C3)CCN(CCCCO)CC1)SCCCCCCCCC |
| InChI | InChI=1S/C47H85NO5S2/c1-3-5-7-9-11-13-17-31-54-45(55-32-18-14-12-10-8-6-4-2)20-19-43(50)52-29-23-46(21-26-48(27-22-46)25-15-16-28-49)24-30-53-44(51)39-47-36-40-33-41(37-47)35-42(34-40)38-47/h40-42,45,49H,3-39H2,1-2H3 |
| InChIKey | RYYSLGAZQMBJHJ-UHFFFAOYSA-N |
| XLogP | 12.39 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.33 |
| LogP ≤ 5 | 12.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|