C14H23FN2O2 — CID 178095860
ethane;5-fluoro-6,7-dimethoxy-3-methyl-2H-indazole (PubChem CID 178095860) has the molecular formula C14H23FN2O2 and a molecular weight of 270.35 g/mol. Its IUPAC name is ethane;5-fluoro-6,7-dimethoxy-3-methyl-2H-indazole.
| Compound Name | ethane;5-fluoro-6,7-dimethoxy-3-methyl-2H-indazole |
|---|---|
| PubChem CID | 178095860 |
| Molecular Formula | C14H23FN2O2 |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | ethane;5-fluoro-6,7-dimethoxy-3-methyl-2H-indazole |
| SMILES | CC.CC.COc1c(F)cc2c(C)[nH]nc2c1OC |
| InChI | InChI=1S/C10H11FN2O2.2C2H6/c1-5-6-4-7(11)9(14-2)10(15-3)8(6)13-12-5;2*1-2/h4H,1-3H3,(H,12,13);2*1-2H3 |
| InChIKey | KOUVQZALDGAYNT-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |