About 5-bromo-3,7-dimethyl-2H-pyrazolo[3,4-c]pyridine;ethane
5-bromo-3,7-dimethyl-2H-pyrazolo[3,4-c]pyridine;ethane (PubChem CID 172572756) has the molecular formula C10H14BrN3
and a molecular weight of 256.15 g/mol. Its IUPAC name is 5-bromo-3,7-dimethyl-2H-pyrazolo[3,4-c]pyridine;ethane.
Molecular Properties
| Compound Name | 5-bromo-3,7-dimethyl-2H-pyrazolo[3,4-c]pyridine;ethane |
| PubChem CID | 172572756 |
| Molecular Formula | C10H14BrN3 |
| Molecular Weight | 256.15 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | 5-bromo-3,7-dimethyl-2H-pyrazolo[3,4-c]pyridine;ethane |
| SMILES | CC.Cc1[nH]nc2c(C)nc(Br)cc12 |
| InChI | InChI=1S/C8H8BrN3.C2H6/c1-4-6-3-7(9)10-5(2)8(6)12-11-4;1-2/h3H,1-2H3,(H,11,12);1-2H3 |
| InChIKey | WZWVGQKBYUMWRE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.15 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-3,7-dimethyl-2H-pyrazolo[3,4-c]pyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3,7-dimethyl-2H-pyrazolo[3,4-c]pyridine;ethane?
The IUPAC name of 5-bromo-3,7-dimethyl-2H-pyrazolo[3,4-c]pyridine;ethane (CID 172572756) is 5-bromo-3,7-dimethyl-2H-pyrazolo[3,4-c]pyridine;ethane.
What is the SMILES notation for 5-bromo-3,7-dimethyl-2H-pyrazolo[3,4-c]pyridine;ethane?
The canonical SMILES for 5-bromo-3,7-dimethyl-2H-pyrazolo[3,4-c]pyridine;ethane is CC.Cc1[nH]nc2c(C)nc(Br)cc12.
What is the InChIKey of 5-bromo-3,7-dimethyl-2H-pyrazolo[3,4-c]pyridine;ethane?
The InChIKey is WZWVGQKBYUMWRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrN3.C2H6/c1-4-6-3-7(9)10-5(2)8(6)12-11-4;1-2/h3H,1-2H3,(H,11,12);1-2H3.
What are the key properties of 5-bromo-3,7-dimethyl-2H-pyrazolo[3,4-c]pyridine;ethane?
5-bromo-3,7-dimethyl-2H-pyrazolo[3,4-c]pyridine;ethane has a molecular weight of 256.15 g/mol, XLogP of 3.36, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3,7-dimethyl-2H-pyrazolo[3,4-c]pyridine;ethane is sourced from PubChem (CID 172572756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).