C9H11N5O — CID 178105415
6,9-dimethyl-12-oxa-2,3,5,7,9-pentazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene (PubChem CID 178105415) has the molecular formula C9H11N5O and a molecular weight of 205.22 g/mol. Its IUPAC name is 6,9-dimethyl-12-oxa-2,3,5,7,9-pentazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene.
| Compound Name | 6,9-dimethyl-12-oxa-2,3,5,7,9-pentazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene |
|---|---|
| PubChem CID | 178105415 |
| Molecular Formula | C9H11N5O |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 6,9-dimethyl-12-oxa-2,3,5,7,9-pentazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene |
| SMILES | Cc1nc2c3c(n[nH]c3n1)OCCN2C |
| InChI | InChI=1S/C9H11N5O/c1-5-10-7-6-8(11-5)14(2)3-4-15-9(6)13-12-7/h3-4H2,1-2H3,(H,10,11,12,13) |
| InChIKey | RPCDANLCMASQIR-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |