About ethane;1-[1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)pyrazol-3-yl]ethanol
ethane;1-[1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)pyrazol-3-yl]ethanol (PubChem CID 178106286) has the molecular formula C13H18N6O
and a molecular weight of 274.33 g/mol. Its IUPAC name is ethane;1-[1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)pyrazol-3-yl]ethanol.
Molecular Properties
| Compound Name | ethane;1-[1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)pyrazol-3-yl]ethanol |
| PubChem CID | 178106286 |
| Molecular Formula | C13H18N6O |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | ethane;1-[1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)pyrazol-3-yl]ethanol |
| SMILES | CC.CC(O)c1ccn(-c2ncnc3c2cnn3C)n1 |
| InChI | InChI=1S/C11H12N6O.C2H6/c1-7(18)9-3-4-17(15-9)11-8-5-14-16(2)10(8)12-6-13-11;1-2/h3-7,18H,1-2H3;1-2H3 |
| InChIKey | RISZGAJTIHRVFU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethane;1-[1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)pyrazol-3-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-[1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)pyrazol-3-yl]ethanol?
The IUPAC name of ethane;1-[1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)pyrazol-3-yl]ethanol (CID 178106286) is ethane;1-[1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)pyrazol-3-yl]ethanol.
What is the SMILES notation for ethane;1-[1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)pyrazol-3-yl]ethanol?
The canonical SMILES for ethane;1-[1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)pyrazol-3-yl]ethanol is CC.CC(O)c1ccn(-c2ncnc3c2cnn3C)n1.
What is the InChIKey of ethane;1-[1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)pyrazol-3-yl]ethanol?
The InChIKey is RISZGAJTIHRVFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N6O.C2H6/c1-7(18)9-3-4-17(15-9)11-8-5-14-16(2)10(8)12-6-13-11;1-2/h3-7,18H,1-2H3;1-2H3.
What are the key properties of ethane;1-[1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)pyrazol-3-yl]ethanol?
ethane;1-[1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)pyrazol-3-yl]ethanol has a molecular weight of 274.33 g/mol, XLogP of 1.63, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-[1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)pyrazol-3-yl]ethanol is sourced from PubChem (CID 178106286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).