C12H13FO2S — CID 178117029
(4-cyclohexa-1,5-dien-1-yloxycyclohexa-1,3-dien-1-yl)oxy thiohypofluorite (PubChem CID 178117029) has the molecular formula C12H13FO2S and a molecular weight of 240.30 g/mol. Its IUPAC name is (4-cyclohexa-1,5-dien-1-yloxycyclohexa-1,3-dien-1-yl)oxy thiohypofluorite.
| Compound Name | (4-cyclohexa-1,5-dien-1-yloxycyclohexa-1,3-dien-1-yl)oxy thiohypofluorite |
|---|---|
| PubChem CID | 178117029 |
| Molecular Formula | C12H13FO2S |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | (4-cyclohexa-1,5-dien-1-yloxycyclohexa-1,3-dien-1-yl)oxy thiohypofluorite |
| SMILES | FSOC1=CC=C(OC2=CCCC=C2)CC1 |
| InChI | InChI=1S/C12H13FO2S/c13-16-15-12-8-6-11(7-9-12)14-10-4-2-1-3-5-10/h2,4-6,8H,1,3,7,9H2 |
| InChIKey | FCTJVEIMUYLPKX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|